About 4,7-dithiophen-2-yl-3H-imidazo[4,5-c]pyridine
4,7-dithiophen-2-yl-3H-imidazo[4,5-c]pyridine (PubChem CID 101144963) has the molecular formula C14H9N3S2
and a molecular weight of 283.38 g/mol. Its IUPAC name is 4,7-dithiophen-2-yl-3H-imidazo[4,5-c]pyridine.
Molecular Properties
| Compound Name | 4,7-dithiophen-2-yl-3H-imidazo[4,5-c]pyridine |
| PubChem CID | 101144963 |
| Molecular Formula | C14H9N3S2 |
| Molecular Weight | 283.38 g/mol |
| Exact Mass | 283.02 |
| IUPAC Name | 4,7-dithiophen-2-yl-3H-imidazo[4,5-c]pyridine |
| SMILES | c1csc(-c2cnc(-c3cccs3)c3[nH]cnc23)c1 |
| InChI | InChI=1S/C14H9N3S2/c1-3-10(18-5-1)9-7-15-13(11-4-2-6-19-11)14-12(9)16-8-17-14/h1-8H,(H,16,17) |
| InChIKey | JGZJBTSDQVCVCZ-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.38 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4,7-dithiophen-2-yl-3H-imidazo[4,5-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,7-dithiophen-2-yl-3H-imidazo[4,5-c]pyridine?
The IUPAC name of 4,7-dithiophen-2-yl-3H-imidazo[4,5-c]pyridine (CID 101144963) is 4,7-dithiophen-2-yl-3H-imidazo[4,5-c]pyridine.
What is the SMILES notation for 4,7-dithiophen-2-yl-3H-imidazo[4,5-c]pyridine?
The canonical SMILES for 4,7-dithiophen-2-yl-3H-imidazo[4,5-c]pyridine is c1csc(-c2cnc(-c3cccs3)c3[nH]cnc23)c1.
What is the InChIKey of 4,7-dithiophen-2-yl-3H-imidazo[4,5-c]pyridine?
The InChIKey is JGZJBTSDQVCVCZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H9N3S2/c1-3-10(18-5-1)9-7-15-13(11-4-2-6-19-11)14-12(9)16-8-17-14/h1-8H,(H,16,17).
What are the key properties of 4,7-dithiophen-2-yl-3H-imidazo[4,5-c]pyridine?
4,7-dithiophen-2-yl-3H-imidazo[4,5-c]pyridine has a molecular weight of 283.38 g/mol, XLogP of 4.41, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4,7-dithiophen-2-yl-3H-imidazo[4,5-c]pyridine is sourced from PubChem (CID 101144963), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).