C17H21NO3 — CID 101145658
[(2S)-1-[(1R,2S,6R,7S)-5-oxo-3-tricyclo[5.2.1.02,6]deca-3,8-dienyl]pyrrolidin-2-yl]methyl acetate (PubChem CID 101145658) has the molecular formula C17H21NO3 and a molecular weight of 287.36 g/mol. Its IUPAC name is [(2S)-1-[(1R,2S,6R,7S)-5-oxo-3-tricyclo[5.2.1.02,6]deca-3,8-dienyl]pyrrolidin-2-yl]methyl acetate.
| Compound Name | [(2S)-1-[(1R,2S,6R,7S)-5-oxo-3-tricyclo[5.2.1.02,6]deca-3,8-dienyl]pyrrolidin-2-yl]methyl acetate |
|---|---|
| PubChem CID | 101145658 |
| Molecular Formula | C17H21NO3 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.15 |
| IUPAC Name | [(2S)-1-[(1R,2S,6R,7S)-5-oxo-3-tricyclo[5.2.1.02,6]deca-3,8-dienyl]pyrrolidin-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@@H]1CCCN1C1=CC(=O)[C@H]2[C@@H]1[C@H]1C=C[C@@H]2C1 |
| InChI | InChI=1S/C17H21NO3/c1-10(19)21-9-13-3-2-6-18(13)14-8-15(20)17-12-5-4-11(7-12)16(14)17/h4-5,8,11-13,16-17H,2-3,6-7,9H2,1H3/t11-,12+,13-,16+,17-/m0/s1 |
| InChIKey | VZDGQPDWUAYTHS-DCRFOKDXSA-N |
| XLogP | 1.92 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|