C22H25N3O3 — CID 101146560
(4R,5S)-1-[(2S)-butan-2-yl]-4-methyl-2,6-dioxo-N,3-diphenyl-1,3-diazinane-5-carboxamide (PubChem CID 101146560) has the molecular formula C22H25N3O3 and a molecular weight of 379.46 g/mol. Its IUPAC name is (4R,5S)-1-[(2S)-butan-2-yl]-4-methyl-2,6-dioxo-N,3-diphenyl-1,3-diazinane-5-carboxamide.
| Compound Name | (4R,5S)-1-[(2S)-butan-2-yl]-4-methyl-2,6-dioxo-N,3-diphenyl-1,3-diazinane-5-carboxamide |
|---|---|
| PubChem CID | 101146560 |
| Molecular Formula | C22H25N3O3 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.19 |
| IUPAC Name | (4R,5S)-1-[(2S)-butan-2-yl]-4-methyl-2,6-dioxo-N,3-diphenyl-1,3-diazinane-5-carboxamide |
| SMILES | CC[C@H](C)N1C(=O)[C@H](C(=O)Nc2ccccc2)[C@@H](C)N(c2ccccc2)C1=O |
| InChI | InChI=1S/C22H25N3O3/c1-4-15(2)24-21(27)19(20(26)23-17-11-7-5-8-12-17)16(3)25(22(24)28)18-13-9-6-10-14-18/h5-16,19H,4H2,1-3H3,(H,23,26)/t15-,16+,19-/m0/s1 |
| InChIKey | ZTAKEWGCWNHYJV-FCEWJHQRSA-N |
| XLogP | 3.90 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|