C8H12FNO3S — CID 101146866
methyl (4R,5S)-5-fluoro-3-formyl-2,2-dimethyl-1,3-thiazolidine-4-carboxylate (PubChem CID 101146866) has the molecular formula C8H12FNO3S and a molecular weight of 221.25 g/mol. Its IUPAC name is methyl (4R,5S)-5-fluoro-3-formyl-2,2-dimethyl-1,3-thiazolidine-4-carboxylate.
| Compound Name | methyl (4R,5S)-5-fluoro-3-formyl-2,2-dimethyl-1,3-thiazolidine-4-carboxylate |
|---|---|
| PubChem CID | 101146866 |
| Molecular Formula | C8H12FNO3S |
| Molecular Weight | 221.25 g/mol |
| Exact Mass | 221.05 |
| IUPAC Name | methyl (4R,5S)-5-fluoro-3-formyl-2,2-dimethyl-1,3-thiazolidine-4-carboxylate |
| SMILES | COC(=O)[C@@H]1[C@@H](F)SC(C)(C)N1C=O |
| InChI | InChI=1S/C8H12FNO3S/c1-8(2)10(4-11)5(6(9)14-8)7(12)13-3/h4-6H,1-3H3/t5-,6-/m0/s1 |
| InChIKey | RLUSMMYHNCYFEM-WDSKDSINSA-N |
| XLogP | 0.76 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.25 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|