C20H25F2N7O3 — CID 10114739
N-(2-carbamimidoyloxazinan-5-yl)-2-[3-[2-(3,4-difluorophenyl)ethylamino]-6-methyl-2-oxopyrazin-1-yl]acetamide (PubChem CID 10114739) has the molecular formula C20H25F2N7O3 and a molecular weight of 449.46 g/mol. Its IUPAC name is N-(2-carbamimidoyloxazinan-5-yl)-2-[3-[2-(3,4-difluorophenyl)ethylamino]-6-methyl-2-oxopyrazin-1-yl]acetamide.
| Compound Name | N-(2-carbamimidoyloxazinan-5-yl)-2-[3-[2-(3,4-difluorophenyl)ethylamino]-6-methyl-2-oxopyrazin-1-yl]acetamide |
|---|---|
| PubChem CID | 10114739 |
| Molecular Formula | C20H25F2N7O3 |
| Molecular Weight | 449.46 g/mol |
| Exact Mass | 449.20 |
| IUPAC Name | N-(2-carbamimidoyloxazinan-5-yl)-2-[3-[2-(3,4-difluorophenyl)ethylamino]-6-methyl-2-oxopyrazin-1-yl]acetamide |
| SMILES | [H]/N=C(\N)N1CCC(NC(=O)Cn2c(C)cnc(NCCc3ccc(F)c(F)c3)c2=O)CO1 |
| InChI | InChI=1S/C20H25F2N7O3/c1-12-9-26-18(25-6-4-13-2-3-15(21)16(22)8-13)19(31)28(12)10-17(30)27-14-5-7-29(20(23)24)32-11-14/h2-3,8-9,14H,4-7,10-11H2,1H3,(H3,23,24)(H,25,26)(H,27,30) |
| InChIKey | NYMJMNNYMNKXBA-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 138.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.46 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|