C15H34O3Si2 — CID 101147414
(2R)-3-[tert-butyl(dimethyl)silyl]oxy-2-triethylsilyloxypropanal (PubChem CID 101147414) has the molecular formula C15H34O3Si2 and a molecular weight of 318.61 g/mol. Its IUPAC name is (2R)-3-[tert-butyl(dimethyl)silyl]oxy-2-triethylsilyloxypropanal.
| Compound Name | (2R)-3-[tert-butyl(dimethyl)silyl]oxy-2-triethylsilyloxypropanal |
|---|---|
| PubChem CID | 101147414 |
| Molecular Formula | C15H34O3Si2 |
| Molecular Weight | 318.61 g/mol |
| Exact Mass | 318.20 |
| IUPAC Name | (2R)-3-[tert-butyl(dimethyl)silyl]oxy-2-triethylsilyloxypropanal |
| SMILES | CC[Si](CC)(CC)O[C@@H](C=O)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C15H34O3Si2/c1-9-20(10-2,11-3)18-14(12-16)13-17-19(7,8)15(4,5)6/h12,14H,9-11,13H2,1-8H3/t14-/m0/s1 |
| InChIKey | NMJQESQJXRYEIC-AWEZNQCLSA-N |
| XLogP | 4.60 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.61 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|