About (2S,3R)-3-butyl-2-cyclohexyl-3,6-dihydro-2H-pyran
(2S,3R)-3-butyl-2-cyclohexyl-3,6-dihydro-2H-pyran (PubChem CID 101147571) has the molecular formula C15H26O
and a molecular weight of 222.37 g/mol. Its IUPAC name is (2S,3R)-3-butyl-2-cyclohexyl-3,6-dihydro-2H-pyran.
Molecular Properties
| Compound Name | (2S,3R)-3-butyl-2-cyclohexyl-3,6-dihydro-2H-pyran |
| PubChem CID | 101147571 |
| Molecular Formula | C15H26O |
| Molecular Weight | 222.37 g/mol |
| Exact Mass | 222.20 |
| IUPAC Name | (2S,3R)-3-butyl-2-cyclohexyl-3,6-dihydro-2H-pyran |
| SMILES | CCCC[C@@H]1C=CCO[C@H]1C1CCCCC1 |
| InChI | InChI=1S/C15H26O/c1-2-3-8-13-11-7-12-16-15(13)14-9-5-4-6-10-14/h7,11,13-15H,2-6,8-10,12H2,1H3/t13-,15-/m1/s1 |
| InChIKey | HLUFJYBQQWYOBT-UKRRQHHQSA-N |
| XLogP | 4.33 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.37 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2S,3R)-3-butyl-2-cyclohexyl-3,6-dihydro-2H-pyran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,3R)-3-butyl-2-cyclohexyl-3,6-dihydro-2H-pyran?
The IUPAC name of (2S,3R)-3-butyl-2-cyclohexyl-3,6-dihydro-2H-pyran (CID 101147571) is (2S,3R)-3-butyl-2-cyclohexyl-3,6-dihydro-2H-pyran.
What is the SMILES notation for (2S,3R)-3-butyl-2-cyclohexyl-3,6-dihydro-2H-pyran?
The canonical SMILES for (2S,3R)-3-butyl-2-cyclohexyl-3,6-dihydro-2H-pyran is CCCC[C@@H]1C=CCO[C@H]1C1CCCCC1.
What is the InChIKey of (2S,3R)-3-butyl-2-cyclohexyl-3,6-dihydro-2H-pyran?
The InChIKey is HLUFJYBQQWYOBT-UKRRQHHQSA-N. The full InChI is InChI=1S/C15H26O/c1-2-3-8-13-11-7-12-16-15(13)14-9-5-4-6-10-14/h7,11,13-15H,2-6,8-10,12H2,1H3/t13-,15-/m1/s1.
What are the key properties of (2S,3R)-3-butyl-2-cyclohexyl-3,6-dihydro-2H-pyran?
(2S,3R)-3-butyl-2-cyclohexyl-3,6-dihydro-2H-pyran has a molecular weight of 222.37 g/mol, XLogP of 4.33, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,3R)-3-butyl-2-cyclohexyl-3,6-dihydro-2H-pyran is sourced from PubChem (CID 101147571), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).