C12H7F5 — CID 101147961
1-cyclohexa-2,4-dien-1-yl-2,3,4,5,6-pentafluorobenzene (PubChem CID 101147961) has the molecular formula C12H7F5 and a molecular weight of 246.18 g/mol. Its IUPAC name is 1-cyclohexa-2,4-dien-1-yl-2,3,4,5,6-pentafluorobenzene.
| Compound Name | 1-cyclohexa-2,4-dien-1-yl-2,3,4,5,6-pentafluorobenzene |
|---|---|
| PubChem CID | 101147961 |
| Molecular Formula | C12H7F5 |
| Molecular Weight | 246.18 g/mol |
| Exact Mass | 246.05 |
| IUPAC Name | 1-cyclohexa-2,4-dien-1-yl-2,3,4,5,6-pentafluorobenzene |
| SMILES | Fc1c(F)c(F)c(C2C=CC=CC2)c(F)c1F |
| InChI | InChI=1S/C12H7F5/c13-8-7(6-4-2-1-3-5-6)9(14)11(16)12(17)10(8)15/h1-4,6H,5H2 |
| InChIKey | FFDIUHRNMLSKPT-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.18 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|