C18H28O3 — CID 101148966
(2S,6R)-4,4,7,13,14,14-hexamethyl-3,5-dioxatricyclo[8.3.1.02,6]tetradec-1(13)-en-9-one (PubChem CID 101148966) has the molecular formula C18H28O3 and a molecular weight of 292.42 g/mol. Its IUPAC name is (2S,6R)-4,4,7,13,14,14-hexamethyl-3,5-dioxatricyclo[8.3.1.02,6]tetradec-1(13)-en-9-one.
| Compound Name | (2S,6R)-4,4,7,13,14,14-hexamethyl-3,5-dioxatricyclo[8.3.1.02,6]tetradec-1(13)-en-9-one |
|---|---|
| PubChem CID | 101148966 |
| Molecular Formula | C18H28O3 |
| Molecular Weight | 292.42 g/mol |
| Exact Mass | 292.20 |
| IUPAC Name | (2S,6R)-4,4,7,13,14,14-hexamethyl-3,5-dioxatricyclo[8.3.1.02,6]tetradec-1(13)-en-9-one |
| SMILES | CC1=C2[C@@H]3OC(C)(C)O[C@@H]3C(C)CC(=O)C(CC1)C2(C)C |
| InChI | InChI=1S/C18H28O3/c1-10-7-8-12-13(19)9-11(2)15-16(14(10)17(12,3)4)21-18(5,6)20-15/h11-12,15-16H,7-9H2,1-6H3/t11?,12?,15-,16+/m1/s1 |
| InChIKey | JEECXUOPKQQIPJ-TUHYSUIHSA-N |
| XLogP | 3.87 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.42 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|