C24H30FN7O — CID 10114914
2-N-benzyl-6-N-[(1-ethylpyrrolidin-2-yl)methyl]-4-N-(3-fluoro-4-methoxyphenyl)-1,3,5-triazine-2,4,6-triamine (PubChem CID 10114914) has the molecular formula C24H30FN7O and a molecular weight of 451.55 g/mol. Its IUPAC name is 2-N-benzyl-6-N-[(1-ethylpyrrolidin-2-yl)methyl]-4-N-(3-fluoro-4-methoxyphenyl)-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N-benzyl-6-N-[(1-ethylpyrrolidin-2-yl)methyl]-4-N-(3-fluoro-4-methoxyphenyl)-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 10114914 |
| Molecular Formula | C24H30FN7O |
| Molecular Weight | 451.55 g/mol |
| Exact Mass | 451.25 |
| IUPAC Name | 2-N-benzyl-6-N-[(1-ethylpyrrolidin-2-yl)methyl]-4-N-(3-fluoro-4-methoxyphenyl)-1,3,5-triazine-2,4,6-triamine |
| SMILES | CCN1CCCC1CNc1nc(NCc2ccccc2)nc(Nc2ccc(OC)c(F)c2)n1 |
| InChI | InChI=1S/C24H30FN7O/c1-3-32-13-7-10-19(32)16-27-23-29-22(26-15-17-8-5-4-6-9-17)30-24(31-23)28-18-11-12-21(33-2)20(25)14-18/h4-6,8-9,11-12,14,19H,3,7,10,13,15-16H2,1-2H3,(H3,26,27,28,29,30,31) |
| InChIKey | ANGLWWRPULECPY-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 87.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.55 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |