C35H45N9 — CID 101149189
28,31,34-trimethyl-28,31,34,36,37,38,39-heptazahexacyclo[12.12.9.13,7.18,12.116,20.121,25]nonatriaconta-3(39),4,6,8,10,12(38),16(37),17,19,21,23,25(36)-dodecaene-1,14-diamine (PubChem CID 101149189) has the molecular formula C35H45N9 and a molecular weight of 591.81 g/mol. Its IUPAC name is 28,31,34-trimethyl-28,31,34,36,37,38,39-heptazahexacyclo[12.12.9.13,7.18,12.116,20.121,25]nonatriaconta-3(39),4,6,8,10,12(38),16(37),17,19,21,23,25(36)-dodecaene-1,14-diamine.
| Compound Name | 28,31,34-trimethyl-28,31,34,36,37,38,39-heptazahexacyclo[12.12.9.13,7.18,12.116,20.121,25]nonatriaconta-3(39),4,6,8,10,12(38),16(37),17,19,21,23,25(36)-dodecaene-1,14-diamine |
|---|---|
| PubChem CID | 101149189 |
| Molecular Formula | C35H45N9 |
| Molecular Weight | 591.81 g/mol |
| Exact Mass | 591.38 |
| IUPAC Name | 28,31,34-trimethyl-28,31,34,36,37,38,39-heptazahexacyclo[12.12.9.13,7.18,12.116,20.121,25]nonatriaconta-3(39),4,6,8,10,12(38),16(37),17,19,21,23,25(36)-dodecaene-1,14-diamine |
| SMILES | CN1CCN(C)CC2(N)Cc3cccc(n3)-c3cccc(n3)CC(N)(Cc3cccc(n3)-c3cccc(n3)C2)CN(C)CC1 |
| InChI | InChI=1S/C35H45N9/c1-42-16-18-43(2)24-34(36)20-26-8-4-12-30(38-26)32-14-6-10-28(40-32)22-35(37,25-44(3)19-17-42)23-29-11-7-15-33(41-29)31-13-5-9-27(21-34)39-31/h4-15H,16-25,36-37H2,1-3H3 |
| InChIKey | BQYGDOOEAMXJTQ-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 113.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.81 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'crown_ether', 'substructure': 'N/A'} |
|---|