C25H26ClN3O3 — CID 10114945
(E)-1-[1-(chloromethyl)-5-hydroxy-1,2-dihydropyrrolo[3,2-f]quinolin-3-yl]-3-[4-[2-(dimethylamino)ethoxy]phenyl]prop-2-en-1-one (PubChem CID 10114945) has the molecular formula C25H26ClN3O3 and a molecular weight of 451.95 g/mol. Its IUPAC name is (E)-1-[1-(chloromethyl)-5-hydroxy-1,2-dihydropyrrolo[3,2-f]quinolin-3-yl]-3-[4-[2-(dimethylamino)ethoxy]phenyl]prop-2-en-1-one.
| Compound Name | (E)-1-[1-(chloromethyl)-5-hydroxy-1,2-dihydropyrrolo[3,2-f]quinolin-3-yl]-3-[4-[2-(dimethylamino)ethoxy]phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 10114945 |
| Molecular Formula | C25H26ClN3O3 |
| Molecular Weight | 451.95 g/mol |
| Exact Mass | 451.17 |
| IUPAC Name | (E)-1-[1-(chloromethyl)-5-hydroxy-1,2-dihydropyrrolo[3,2-f]quinolin-3-yl]-3-[4-[2-(dimethylamino)ethoxy]phenyl]prop-2-en-1-one |
| SMILES | CN(C)CCOc1ccc(/C=C/C(=O)N2CC(CCl)c3c2cc(O)c2ncccc32)cc1 |
| InChI | InChI=1S/C25H26ClN3O3/c1-28(2)12-13-32-19-8-5-17(6-9-19)7-10-23(31)29-16-18(15-26)24-20-4-3-11-27-25(20)22(30)14-21(24)29/h3-11,14,18,30H,12-13,15-16H2,1-2H3/b10-7+ |
| InChIKey | PEUBWYDFDULAOF-JXMROGBWSA-N |
| XLogP | 4.26 |
| TPSA | 65.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.95 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|