C23H24F4N2O3 — CID 10114968
8-[3-[bis(3,4-difluorophenyl)methoxy]propyl]-1-oxa-3,8-diazaspiro[4.5]decan-2-one (PubChem CID 10114968) has the molecular formula C23H24F4N2O3 and a molecular weight of 452.45 g/mol. Its IUPAC name is 8-[3-[bis(3,4-difluorophenyl)methoxy]propyl]-1-oxa-3,8-diazaspiro[4.5]decan-2-one.
| Compound Name | 8-[3-[bis(3,4-difluorophenyl)methoxy]propyl]-1-oxa-3,8-diazaspiro[4.5]decan-2-one |
|---|---|
| PubChem CID | 10114968 |
| Molecular Formula | C23H24F4N2O3 |
| Molecular Weight | 452.45 g/mol |
| Exact Mass | 452.17 |
| IUPAC Name | 8-[3-[bis(3,4-difluorophenyl)methoxy]propyl]-1-oxa-3,8-diazaspiro[4.5]decan-2-one |
| SMILES | O=C1NCC2(CCN(CCCOC(c3ccc(F)c(F)c3)c3ccc(F)c(F)c3)CC2)O1 |
| InChI | InChI=1S/C23H24F4N2O3/c24-17-4-2-15(12-19(17)26)21(16-3-5-18(25)20(27)13-16)31-11-1-8-29-9-6-23(7-10-29)14-28-22(30)32-23/h2-5,12-13,21H,1,6-11,14H2,(H,28,30) |
| InChIKey | YYTWGBTYYVWRRT-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.45 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|