C26H42O3Si — CID 101149975
(1aR,1bR,3aR,7aR,7bS,9aR)-3a-acetyl-9a-[tert-butyl(dimethyl)silyl]oxy-1a,5,7b-trimethyl-1,1b,2,3,7,7a,8,9-octahydrocyclopropa[a]phenanthren-4-one (PubChem CID 101149975) has the molecular formula C26H42O3Si and a molecular weight of 430.71 g/mol. Its IUPAC name is (1aR,1bR,3aR,7aR,7bS,9aR)-3a-acetyl-9a-[tert-butyl(dimethyl)silyl]oxy-1a,5,7b-trimethyl-1,1b,2,3,7,7a,8,9-octahydrocyclopropa[a]phenanthren-4-one.
| Compound Name | (1aR,1bR,3aR,7aR,7bS,9aR)-3a-acetyl-9a-[tert-butyl(dimethyl)silyl]oxy-1a,5,7b-trimethyl-1,1b,2,3,7,7a,8,9-octahydrocyclopropa[a]phenanthren-4-one |
|---|---|
| PubChem CID | 101149975 |
| Molecular Formula | C26H42O3Si |
| Molecular Weight | 430.71 g/mol |
| Exact Mass | 430.29 |
| IUPAC Name | (1aR,1bR,3aR,7aR,7bS,9aR)-3a-acetyl-9a-[tert-butyl(dimethyl)silyl]oxy-1a,5,7b-trimethyl-1,1b,2,3,7,7a,8,9-octahydrocyclopropa[a]phenanthren-4-one |
| SMILES | CC(=O)[C@@]12CC[C@@H]3[C@](C)(CC[C@@]4(O[Si](C)(C)C(C)(C)C)C[C@]34C)[C@H]1CC=C(C)C2=O |
| InChI | InChI=1S/C26H42O3Si/c1-17-10-11-20-23(6)14-15-25(29-30(8,9)22(3,4)5)16-24(25,7)19(23)12-13-26(20,18(2)27)21(17)28/h10,19-20H,11-16H2,1-9H3/t19-,20-,23+,24-,25-,26+/m1/s1 |
| InChIKey | WPHJPPIFIPDNMA-DWUAMQTRSA-N |
| XLogP | 6.48 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.71 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|