C18H28OS — CID 101150541
(3aS,3bS,9aR,9bS,11aS)-9a,11a-dimethyl-3,3a,3b,4,5,5a,7,8,9,9b,10,11-dodecahydro-2H-indeno[5,4-f]thiochromen-1-one (PubChem CID 101150541) has the molecular formula C18H28OS and a molecular weight of 292.49 g/mol. Its IUPAC name is (3aS,3bS,9aR,9bS,11aS)-9a,11a-dimethyl-3,3a,3b,4,5,5a,7,8,9,9b,10,11-dodecahydro-2H-indeno[5,4-f]thiochromen-1-one.
| Compound Name | (3aS,3bS,9aR,9bS,11aS)-9a,11a-dimethyl-3,3a,3b,4,5,5a,7,8,9,9b,10,11-dodecahydro-2H-indeno[5,4-f]thiochromen-1-one |
|---|---|
| PubChem CID | 101150541 |
| Molecular Formula | C18H28OS |
| Molecular Weight | 292.49 g/mol |
| Exact Mass | 292.19 |
| IUPAC Name | (3aS,3bS,9aR,9bS,11aS)-9a,11a-dimethyl-3,3a,3b,4,5,5a,7,8,9,9b,10,11-dodecahydro-2H-indeno[5,4-f]thiochromen-1-one |
| SMILES | C[C@]12CCCSC1CC[C@@H]1[C@@H]2CC[C@]2(C)C(=O)CC[C@@H]12 |
| InChI | InChI=1S/C18H28OS/c1-17-10-8-14-12(13(17)5-6-15(17)19)4-7-16-18(14,2)9-3-11-20-16/h12-14,16H,3-11H2,1-2H3/t12-,13-,14-,16?,17-,18+/m0/s1 |
| InChIKey | VSWVMAHIAPGDMH-RMQPPWHISA-N |
| XLogP | 4.69 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.49 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |