C22H18O3 — CID 101151117
3,3,7-triphenyl-7H-1,2,4-trioxepine (PubChem CID 101151117) has the molecular formula C22H18O3 and a molecular weight of 330.38 g/mol. Its IUPAC name is 3,3,7-triphenyl-7H-1,2,4-trioxepine.
| Compound Name | 3,3,7-triphenyl-7H-1,2,4-trioxepine |
|---|---|
| PubChem CID | 101151117 |
| Molecular Formula | C22H18O3 |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.13 |
| IUPAC Name | 3,3,7-triphenyl-7H-1,2,4-trioxepine |
| SMILES | C1=CC(c2ccccc2)OOC(c2ccccc2)(c2ccccc2)O1 |
| InChI | InChI=1S/C22H18O3/c1-4-10-18(11-5-1)21-16-17-23-22(25-24-21,19-12-6-2-7-13-19)20-14-8-3-9-15-20/h1-17,21H |
| InChIKey | OMQLRIORQKZCOO-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|