C22H22N2O3S — CID 1011516
1-[(4-piperidin-1-ylsulfonylphenyl)iminomethyl]naphthalen-2-ol (PubChem CID 1011516) has the molecular formula C22H22N2O3S and a molecular weight of 394.50 g/mol. Its IUPAC name is 1-[(4-piperidin-1-ylsulfonylphenyl)iminomethyl]naphthalen-2-ol.
| Compound Name | 1-[(4-piperidin-1-ylsulfonylphenyl)iminomethyl]naphthalen-2-ol |
|---|---|
| PubChem CID | 1011516 |
| Molecular Formula | C22H22N2O3S |
| Molecular Weight | 394.50 g/mol |
| Exact Mass | 394.14 |
| IUPAC Name | 1-[(4-piperidin-1-ylsulfonylphenyl)iminomethyl]naphthalen-2-ol |
| SMILES | O=S(=O)(c1ccc(/N=C/c2c(O)ccc3ccccc23)cc1)N1CCCCC1 |
| InChI | InChI=1S/C22H22N2O3S/c25-22-13-8-17-6-2-3-7-20(17)21(22)16-23-18-9-11-19(12-10-18)28(26,27)24-14-4-1-5-15-24/h2-3,6-13,16,25H,1,4-5,14-15H2/b23-16+ |
| InChIKey | RBFCISNFMKBGJM-XQNSMLJCSA-N |
| XLogP | 4.47 |
| TPSA | 69.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.50 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|