C29H35NO2 — CID 101151798
(2S,4S,5S)-2-(dibenzylamino)-5-hydroxy-4,6-dimethyl-1-phenylheptan-3-one (PubChem CID 101151798) has the molecular formula C29H35NO2 and a molecular weight of 429.60 g/mol. Its IUPAC name is (2S,4S,5S)-2-(dibenzylamino)-5-hydroxy-4,6-dimethyl-1-phenylheptan-3-one.
| Compound Name | (2S,4S,5S)-2-(dibenzylamino)-5-hydroxy-4,6-dimethyl-1-phenylheptan-3-one |
|---|---|
| PubChem CID | 101151798 |
| Molecular Formula | C29H35NO2 |
| Molecular Weight | 429.60 g/mol |
| Exact Mass | 429.27 |
| IUPAC Name | (2S,4S,5S)-2-(dibenzylamino)-5-hydroxy-4,6-dimethyl-1-phenylheptan-3-one |
| SMILES | CC(C)[C@H](O)[C@H](C)C(=O)[C@H](Cc1ccccc1)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C29H35NO2/c1-22(2)28(31)23(3)29(32)27(19-24-13-7-4-8-14-24)30(20-25-15-9-5-10-16-25)21-26-17-11-6-12-18-26/h4-18,22-23,27-28,31H,19-21H2,1-3H3/t23-,27-,28-/m0/s1 |
| InChIKey | CSASMDQYAXRQER-RNCAPKPVSA-N |
| XLogP | 5.52 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.60 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |