C24H16F4N2O3 — CID 10115219
3,4-bis(4-methoxyphenyl)-6-(2,3,5,6-tetrafluorophenoxy)pyridazine (PubChem CID 10115219) has the molecular formula C24H16F4N2O3 and a molecular weight of 456.40 g/mol. Its IUPAC name is 3,4-bis(4-methoxyphenyl)-6-(2,3,5,6-tetrafluorophenoxy)pyridazine.
| Compound Name | 3,4-bis(4-methoxyphenyl)-6-(2,3,5,6-tetrafluorophenoxy)pyridazine |
|---|---|
| PubChem CID | 10115219 |
| Molecular Formula | C24H16F4N2O3 |
| Molecular Weight | 456.40 g/mol |
| Exact Mass | 456.11 |
| IUPAC Name | 3,4-bis(4-methoxyphenyl)-6-(2,3,5,6-tetrafluorophenoxy)pyridazine |
| SMILES | COc1ccc(-c2cc(Oc3c(F)c(F)cc(F)c3F)nnc2-c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C24H16F4N2O3/c1-31-15-7-3-13(4-8-15)17-11-20(33-24-21(27)18(25)12-19(26)22(24)28)29-30-23(17)14-5-9-16(32-2)10-6-14/h3-12H,1-2H3 |
| InChIKey | VTVQNZDIYAEJIS-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 53.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.40 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|