About methyl 2-[2-[7-(diethylamino)-2-oxochromen-3-yl]-1,3-thiazol-4-yl]acetate
methyl 2-[2-[7-(diethylamino)-2-oxochromen-3-yl]-1,3-thiazol-4-yl]acetate (PubChem CID 101152219) has the molecular formula C19H20N2O4S
and a molecular weight of 372.45 g/mol. Its IUPAC name is methyl 2-[2-[7-(diethylamino)-2-oxochromen-3-yl]-1,3-thiazol-4-yl]acetate.
Molecular Properties
| Compound Name | methyl 2-[2-[7-(diethylamino)-2-oxochromen-3-yl]-1,3-thiazol-4-yl]acetate |
| PubChem CID | 101152219 |
| Molecular Formula | C19H20N2O4S |
| Molecular Weight | 372.45 g/mol |
| Exact Mass | 372.11 |
| IUPAC Name | methyl 2-[2-[7-(diethylamino)-2-oxochromen-3-yl]-1,3-thiazol-4-yl]acetate |
| SMILES | CCN(CC)c1ccc2cc(-c3nc(CC(=O)OC)cs3)c(=O)oc2c1 |
| InChI | InChI=1S/C19H20N2O4S/c1-4-21(5-2)14-7-6-12-8-15(19(23)25-16(12)10-14)18-20-13(11-26-18)9-17(22)24-3/h6-8,10-11H,4-5,9H2,1-3H3 |
| InChIKey | KXUHDMCLDKCVTC-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 72.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.45 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-[2-[7-(diethylamino)-2-oxochromen-3-yl]-1,3-thiazol-4-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[2-[7-(diethylamino)-2-oxochromen-3-yl]-1,3-thiazol-4-yl]acetate?
The IUPAC name of methyl 2-[2-[7-(diethylamino)-2-oxochromen-3-yl]-1,3-thiazol-4-yl]acetate (CID 101152219) is methyl 2-[2-[7-(diethylamino)-2-oxochromen-3-yl]-1,3-thiazol-4-yl]acetate.
What is the SMILES notation for methyl 2-[2-[7-(diethylamino)-2-oxochromen-3-yl]-1,3-thiazol-4-yl]acetate?
The canonical SMILES for methyl 2-[2-[7-(diethylamino)-2-oxochromen-3-yl]-1,3-thiazol-4-yl]acetate is CCN(CC)c1ccc2cc(-c3nc(CC(=O)OC)cs3)c(=O)oc2c1.
What is the InChIKey of methyl 2-[2-[7-(diethylamino)-2-oxochromen-3-yl]-1,3-thiazol-4-yl]acetate?
The InChIKey is KXUHDMCLDKCVTC-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20N2O4S/c1-4-21(5-2)14-7-6-12-8-15(19(23)25-16(12)10-14)18-20-13(11-26-18)9-17(22)24-3/h6-8,10-11H,4-5,9H2,1-3H3.
What are the key properties of methyl 2-[2-[7-(diethylamino)-2-oxochromen-3-yl]-1,3-thiazol-4-yl]acetate?
methyl 2-[2-[7-(diethylamino)-2-oxochromen-3-yl]-1,3-thiazol-4-yl]acetate has a molecular weight of 372.45 g/mol, XLogP of 3.48, 6 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[2-[7-(diethylamino)-2-oxochromen-3-yl]-1,3-thiazol-4-yl]acetate is sourced from PubChem (CID 101152219), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).