C13H24O6S — CID 101152763
methyl 6-[(2S,3S,4R,5S,6R)-3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl]hexanoate (PubChem CID 101152763) has the molecular formula C13H24O6S and a molecular weight of 308.40 g/mol. Its IUPAC name is methyl 6-[(2S,3S,4R,5S,6R)-3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl]hexanoate.
| Compound Name | methyl 6-[(2S,3S,4R,5S,6R)-3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl]hexanoate |
|---|---|
| PubChem CID | 101152763 |
| Molecular Formula | C13H24O6S |
| Molecular Weight | 308.40 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | methyl 6-[(2S,3S,4R,5S,6R)-3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl]hexanoate |
| SMILES | COC(=O)CCCCC[C@@H]1O[C@H](SC)[C@@H](O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C13H24O6S/c1-18-9(14)7-5-3-4-6-8-10(15)11(16)12(17)13(19-8)20-2/h8,10-13,15-17H,3-7H2,1-2H3/t8-,10+,11+,12-,13+/m0/s1 |
| InChIKey | VUVBFZFRKFJTGL-ZYJFBCHUSA-N |
| XLogP | 0.28 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.40 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|