C16H15F4N3S2 — CID 101152986
2-[4-[[4-(dimethylamino)phenyl]diazenyl]-2,3,5,6-tetrafluorophenyl]sulfanylethanethiol (PubChem CID 101152986) has the molecular formula C16H15F4N3S2 and a molecular weight of 389.44 g/mol. Its IUPAC name is 2-[4-[[4-(dimethylamino)phenyl]diazenyl]-2,3,5,6-tetrafluorophenyl]sulfanylethanethiol.
| Compound Name | 2-[4-[[4-(dimethylamino)phenyl]diazenyl]-2,3,5,6-tetrafluorophenyl]sulfanylethanethiol |
|---|---|
| PubChem CID | 101152986 |
| Molecular Formula | C16H15F4N3S2 |
| Molecular Weight | 389.44 g/mol |
| Exact Mass | 389.06 |
| IUPAC Name | 2-[4-[[4-(dimethylamino)phenyl]diazenyl]-2,3,5,6-tetrafluorophenyl]sulfanylethanethiol |
| SMILES | CN(C)c1ccc(/N=N/c2c(F)c(F)c(SCCS)c(F)c2F)cc1 |
| InChI | InChI=1S/C16H15F4N3S2/c1-23(2)10-5-3-9(4-6-10)21-22-15-11(17)13(19)16(25-8-7-24)14(20)12(15)18/h3-6,24H,7-8H2,1-2H3/b22-21+ |
| InChIKey | PMDHWDUUPFWGBM-QURGRASLSA-N |
| XLogP | 5.75 |
| TPSA | 27.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.44 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|