C30H24F8N6S2 — CID 101152987
4-[[4-[2-[4-[[4-(dimethylamino)phenyl]diazenyl]-2,3,5,6-tetrafluorophenyl]sulfanylethylsulfanyl]-2,3,5,6-tetrafluorophenyl]diazenyl]-N,N-dimethylaniline (PubChem CID 101152987) has the molecular formula C30H24F8N6S2 and a molecular weight of 684.68 g/mol. Its IUPAC name is 4-[[4-[2-[4-[[4-(dimethylamino)phenyl]diazenyl]-2,3,5,6-tetrafluorophenyl]sulfanylethylsulfanyl]-2,3,5,6-tetrafluorophenyl]diazenyl]-N,N-dimethylaniline.
| Compound Name | 4-[[4-[2-[4-[[4-(dimethylamino)phenyl]diazenyl]-2,3,5,6-tetrafluorophenyl]sulfanylethylsulfanyl]-2,3,5,6-tetrafluorophenyl]diazenyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 101152987 |
| Molecular Formula | C30H24F8N6S2 |
| Molecular Weight | 684.68 g/mol |
| Exact Mass | 684.14 |
| IUPAC Name | 4-[[4-[2-[4-[[4-(dimethylamino)phenyl]diazenyl]-2,3,5,6-tetrafluorophenyl]sulfanylethylsulfanyl]-2,3,5,6-tetrafluorophenyl]diazenyl]-N,N-dimethylaniline |
| SMILES | CN(C)c1ccc(/N=N/c2c(F)c(F)c(SCCSc3c(F)c(F)c(/N=N/c4ccc(N(C)C)cc4)c(F)c3F)c(F)c2F)cc1 |
| InChI | InChI=1S/C30H24F8N6S2/c1-43(2)17-9-5-15(6-10-17)39-41-27-19(31)23(35)29(24(36)20(27)32)45-13-14-46-30-25(37)21(33)28(22(34)26(30)38)42-40-16-7-11-18(12-8-16)44(3)4/h5-12H,13-14H2,1-4H3/b41-39+,42-40+ |
| InChIKey | ISYXQXXWIIYPIM-LMXNTIJMSA-N |
| XLogP | 10.65 |
| TPSA | 55.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.68 |
| LogP ≤ 5 | 10.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|