C12H14O2 — CID 101153120
(5aR,6aS,9aR,9bS)-3,5a,6,6a,9a,9b-hexahydro-1H-pentaleno[1,2-c]oxepin-9-one (PubChem CID 101153120) has the molecular formula C12H14O2 and a molecular weight of 190.24 g/mol. Its IUPAC name is (5aR,6aS,9aR,9bS)-3,5a,6,6a,9a,9b-hexahydro-1H-pentaleno[1,2-c]oxepin-9-one.
| Compound Name | (5aR,6aS,9aR,9bS)-3,5a,6,6a,9a,9b-hexahydro-1H-pentaleno[1,2-c]oxepin-9-one |
|---|---|
| PubChem CID | 101153120 |
| Molecular Formula | C12H14O2 |
| Molecular Weight | 190.24 g/mol |
| Exact Mass | 190.10 |
| IUPAC Name | (5aR,6aS,9aR,9bS)-3,5a,6,6a,9a,9b-hexahydro-1H-pentaleno[1,2-c]oxepin-9-one |
| SMILES | O=C1C=C[C@@H]2C[C@@H]3C=CCOC[C@@H]3[C@H]12 |
| InChI | InChI=1S/C12H14O2/c13-11-4-3-9-6-8-2-1-5-14-7-10(8)12(9)11/h1-4,8-10,12H,5-7H2/t8-,9+,10-,12+/m0/s1 |
| InChIKey | WVUJQINQCJULMZ-MIZYBKAJSA-N |
| XLogP | 1.58 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.24 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|