C5Cl2F9IO — CID 101153179
1-(1,2-dichloro-1,2,2-trifluoroethoxy)-1,1,2,3,3,3-hexafluoro-2-iodopropane (PubChem CID 101153179) has the molecular formula C5Cl2F9IO and a molecular weight of 444.85 g/mol. Its IUPAC name is 1-(1,2-dichloro-1,2,2-trifluoroethoxy)-1,1,2,3,3,3-hexafluoro-2-iodopropane.
| Compound Name | 1-(1,2-dichloro-1,2,2-trifluoroethoxy)-1,1,2,3,3,3-hexafluoro-2-iodopropane |
|---|---|
| PubChem CID | 101153179 |
| Molecular Formula | C5Cl2F9IO |
| Molecular Weight | 444.85 g/mol |
| Exact Mass | 443.82 |
| IUPAC Name | 1-(1,2-dichloro-1,2,2-trifluoroethoxy)-1,1,2,3,3,3-hexafluoro-2-iodopropane |
| SMILES | FC(F)(F)C(F)(I)C(F)(F)OC(F)(Cl)C(F)(F)Cl |
| InChI | InChI=1S/C5Cl2F9IO/c6-2(9,10)3(7,11)18-5(15,16)1(8,17)4(12,13)14 |
| InChIKey | WTJZYMPTLORTMX-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.85 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|