C18H31NO2 — CID 101153414
(2E,4E,8Z)-11-hydroxy-N-(2-methylpropyl)tetradeca-2,4,8-trienamide (PubChem CID 101153414) has the molecular formula C18H31NO2 and a molecular weight of 293.45 g/mol. Its IUPAC name is (2E,4E,8Z)-11-hydroxy-N-(2-methylpropyl)tetradeca-2,4,8-trienamide.
| Compound Name | (2E,4E,8Z)-11-hydroxy-N-(2-methylpropyl)tetradeca-2,4,8-trienamide |
|---|---|
| PubChem CID | 101153414 |
| Molecular Formula | C18H31NO2 |
| Molecular Weight | 293.45 g/mol |
| Exact Mass | 293.24 |
| IUPAC Name | (2E,4E,8Z)-11-hydroxy-N-(2-methylpropyl)tetradeca-2,4,8-trienamide |
| SMILES | CCCC(O)C/C=C\CC/C=C/C=C/C(=O)NCC(C)C |
| InChI | InChI=1S/C18H31NO2/c1-4-12-17(20)13-10-8-6-5-7-9-11-14-18(21)19-15-16(2)3/h7-11,14,16-17,20H,4-6,12-13,15H2,1-3H3,(H,19,21)/b9-7+,10-8-,14-11+ |
| InChIKey | AGSDDWKTIRYHSX-UHGNTMHVSA-N |
| XLogP | 3.76 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.45 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|