C25H36O16S — CID 101153463
[(2R,3R,4S,5R,6R)-4,5-diacetyloxy-6-methoxy-3-[(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-(sulfanylmethyl)oxan-2-yl]oxyoxan-2-yl]methyl acetate (PubChem CID 101153463) has the molecular formula C25H36O16S and a molecular weight of 624.61 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6R)-4,5-diacetyloxy-6-methoxy-3-[(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-(sulfanylmethyl)oxan-2-yl]oxyoxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R,6R)-4,5-diacetyloxy-6-methoxy-3-[(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-(sulfanylmethyl)oxan-2-yl]oxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 101153463 |
| Molecular Formula | C25H36O16S |
| Molecular Weight | 624.61 g/mol |
| Exact Mass | 624.17 |
| IUPAC Name | [(2R,3R,4S,5R,6R)-4,5-diacetyloxy-6-methoxy-3-[(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-(sulfanylmethyl)oxan-2-yl]oxyoxan-2-yl]methyl acetate |
| SMILES | CO[C@@H]1O[C@H](COC(C)=O)[C@@H](O[C@@H]2O[C@H](CS)[C@H](OC(C)=O)[C@H](OC(C)=O)[C@H]2OC(C)=O)[C@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C25H36O16S/c1-10(26)33-8-16-18(20(35-12(3)28)22(37-14(5)30)24(32-7)39-16)41-25-23(38-15(6)31)21(36-13(4)29)19(34-11(2)27)17(9-42)40-25/h16-25,42H,8-9H2,1-7H3/t16-,17-,18-,19+,20+,21+,22-,23-,24-,25+/m1/s1 |
| InChIKey | FTUJDOVMNYTRAK-MLIJZFBGSA-N |
| XLogP | -0.38 |
| TPSA | 194.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.61 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|