C18H29NO2Si — CID 101153615
(2S,3R)-3-phenylmethoxy-2-trimethylsilyloxyoctanenitrile (PubChem CID 101153615) has the molecular formula C18H29NO2Si and a molecular weight of 319.52 g/mol. Its IUPAC name is (2S,3R)-3-phenylmethoxy-2-trimethylsilyloxyoctanenitrile.
| Compound Name | (2S,3R)-3-phenylmethoxy-2-trimethylsilyloxyoctanenitrile |
|---|---|
| PubChem CID | 101153615 |
| Molecular Formula | C18H29NO2Si |
| Molecular Weight | 319.52 g/mol |
| Exact Mass | 319.20 |
| IUPAC Name | (2S,3R)-3-phenylmethoxy-2-trimethylsilyloxyoctanenitrile |
| SMILES | CCCCC[C@@H](OCc1ccccc1)[C@H](C#N)O[Si](C)(C)C |
| InChI | InChI=1S/C18H29NO2Si/c1-5-6-8-13-17(18(14-19)21-22(2,3)4)20-15-16-11-9-7-10-12-16/h7,9-12,17-18H,5-6,8,13,15H2,1-4H3/t17-,18+/m1/s1 |
| InChIKey | HMOMXUWPWAHQQC-MSOLQXFVSA-N |
| XLogP | 4.90 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.52 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|