C14H24O6 — CID 101153652
(2R,3R,4aS,5R,8aR)-2,3-dimethoxy-5-(methoxymethoxy)-2,3-dimethyl-4a,5,6,8a-tetrahydro-1,4-benzodioxine (PubChem CID 101153652) has the molecular formula C14H24O6 and a molecular weight of 288.34 g/mol. Its IUPAC name is (2R,3R,4aS,5R,8aR)-2,3-dimethoxy-5-(methoxymethoxy)-2,3-dimethyl-4a,5,6,8a-tetrahydro-1,4-benzodioxine.
| Compound Name | (2R,3R,4aS,5R,8aR)-2,3-dimethoxy-5-(methoxymethoxy)-2,3-dimethyl-4a,5,6,8a-tetrahydro-1,4-benzodioxine |
|---|---|
| PubChem CID | 101153652 |
| Molecular Formula | C14H24O6 |
| Molecular Weight | 288.34 g/mol |
| Exact Mass | 288.16 |
| IUPAC Name | (2R,3R,4aS,5R,8aR)-2,3-dimethoxy-5-(methoxymethoxy)-2,3-dimethyl-4a,5,6,8a-tetrahydro-1,4-benzodioxine |
| SMILES | COCO[C@@H]1CC=C[C@H]2O[C@@](C)(OC)[C@](C)(OC)O[C@H]21 |
| InChI | InChI=1S/C14H24O6/c1-13(16-4)14(2,17-5)20-12-10(18-9-15-3)7-6-8-11(12)19-13/h6,8,10-12H,7,9H2,1-5H3/t10-,11-,12+,13-,14-/m1/s1 |
| InChIKey | FWGWZKBPKKOUHJ-RKQHYHRCSA-N |
| XLogP | 1.44 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.34 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|