C13H19NO3 — CID 101153674
ethyl (1R,3aR,7aS)-1-cyano-7a-hydroxy-2,3,4,5,6,7-hexahydro-1H-indene-3a-carboxylate (PubChem CID 101153674) has the molecular formula C13H19NO3 and a molecular weight of 237.30 g/mol. Its IUPAC name is ethyl (1R,3aR,7aS)-1-cyano-7a-hydroxy-2,3,4,5,6,7-hexahydro-1H-indene-3a-carboxylate.
| Compound Name | ethyl (1R,3aR,7aS)-1-cyano-7a-hydroxy-2,3,4,5,6,7-hexahydro-1H-indene-3a-carboxylate |
|---|---|
| PubChem CID | 101153674 |
| Molecular Formula | C13H19NO3 |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.14 |
| IUPAC Name | ethyl (1R,3aR,7aS)-1-cyano-7a-hydroxy-2,3,4,5,6,7-hexahydro-1H-indene-3a-carboxylate |
| SMILES | CCOC(=O)[C@@]12CCCC[C@]1(O)[C@@H](C#N)CC2 |
| InChI | InChI=1S/C13H19NO3/c1-2-17-11(15)12-6-3-4-7-13(12,16)10(9-14)5-8-12/h10,16H,2-8H2,1H3/t10-,12+,13+/m1/s1 |
| InChIKey | QMSJISUFXRFQCW-WXHSDQCUSA-N |
| XLogP | 1.77 |
| TPSA | 70.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |