C12H18O5 — CID 101154036
(1S,2S,6R,9S)-4,4,11,11-tetramethyl-3,5,10,12-tetraoxatricyclo[7.3.0.02,6]dodecan-7-one (PubChem CID 101154036) has the molecular formula C12H18O5 and a molecular weight of 242.27 g/mol. Its IUPAC name is (1S,2S,6R,9S)-4,4,11,11-tetramethyl-3,5,10,12-tetraoxatricyclo[7.3.0.02,6]dodecan-7-one.
| Compound Name | (1S,2S,6R,9S)-4,4,11,11-tetramethyl-3,5,10,12-tetraoxatricyclo[7.3.0.02,6]dodecan-7-one |
|---|---|
| PubChem CID | 101154036 |
| Molecular Formula | C12H18O5 |
| Molecular Weight | 242.27 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | (1S,2S,6R,9S)-4,4,11,11-tetramethyl-3,5,10,12-tetraoxatricyclo[7.3.0.02,6]dodecan-7-one |
| SMILES | CC1(C)O[C@@H]2[C@@H]3OC(C)(C)O[C@H]3C(=O)C[C@@H]2O1 |
| InChI | InChI=1S/C12H18O5/c1-11(2)14-7-5-6(13)8-10(9(7)16-11)17-12(3,4)15-8/h7-10H,5H2,1-4H3/t7-,8-,9-,10+/m0/s1 |
| InChIKey | COXSXIHCKVBZHZ-AATLWQCWSA-N |
| XLogP | 1.00 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.27 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |