About dimethyl 2-(3-oxopropyl)-2-[(2E)-penta-2,4-dienyl]propanedioate
dimethyl 2-(3-oxopropyl)-2-[(2E)-penta-2,4-dienyl]propanedioate (PubChem CID 101154161) has the molecular formula C13H18O5
and a molecular weight of 254.28 g/mol. Its IUPAC name is dimethyl 2-(3-oxopropyl)-2-[(2E)-penta-2,4-dienyl]propanedioate.
Molecular Properties
| Compound Name | dimethyl 2-(3-oxopropyl)-2-[(2E)-penta-2,4-dienyl]propanedioate |
| PubChem CID | 101154161 |
| Molecular Formula | C13H18O5 |
| Molecular Weight | 254.28 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | dimethyl 2-(3-oxopropyl)-2-[(2E)-penta-2,4-dienyl]propanedioate |
| SMILES | C=C/C=C/CC(CCC=O)(C(=O)OC)C(=O)OC |
| InChI | InChI=1S/C13H18O5/c1-4-5-6-8-13(9-7-10-14,11(15)17-2)12(16)18-3/h4-6,10H,1,7-9H2,2-3H3/b6-5+ |
| InChIKey | PVOIGLOHWGRYNT-AATRIKPKSA-N |
| XLogP | 1.43 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.28 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze dimethyl 2-(3-oxopropyl)-2-[(2E)-penta-2,4-dienyl]propanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl 2-(3-oxopropyl)-2-[(2E)-penta-2,4-dienyl]propanedioate?
The IUPAC name of dimethyl 2-(3-oxopropyl)-2-[(2E)-penta-2,4-dienyl]propanedioate (CID 101154161) is dimethyl 2-(3-oxopropyl)-2-[(2E)-penta-2,4-dienyl]propanedioate.
What is the SMILES notation for dimethyl 2-(3-oxopropyl)-2-[(2E)-penta-2,4-dienyl]propanedioate?
The canonical SMILES for dimethyl 2-(3-oxopropyl)-2-[(2E)-penta-2,4-dienyl]propanedioate is C=C/C=C/CC(CCC=O)(C(=O)OC)C(=O)OC.
What is the InChIKey of dimethyl 2-(3-oxopropyl)-2-[(2E)-penta-2,4-dienyl]propanedioate?
The InChIKey is PVOIGLOHWGRYNT-AATRIKPKSA-N. The full InChI is InChI=1S/C13H18O5/c1-4-5-6-8-13(9-7-10-14,11(15)17-2)12(16)18-3/h4-6,10H,1,7-9H2,2-3H3/b6-5+.
What are the key properties of dimethyl 2-(3-oxopropyl)-2-[(2E)-penta-2,4-dienyl]propanedioate?
dimethyl 2-(3-oxopropyl)-2-[(2E)-penta-2,4-dienyl]propanedioate has a molecular weight of 254.28 g/mol, XLogP of 1.43, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl 2-(3-oxopropyl)-2-[(2E)-penta-2,4-dienyl]propanedioate is sourced from PubChem (CID 101154161), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).