C28H52O4Si2 — CID 101154481
tert-butyl-[(1S,3S)-1-[(4R,5R)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]-3-ethynyl-3-triethylsilyloxyhept-6-enoxy]-dimethylsilane (PubChem CID 101154481) has the molecular formula C28H52O4Si2 and a molecular weight of 508.89 g/mol. Its IUPAC name is tert-butyl-[(1S,3S)-1-[(4R,5R)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]-3-ethynyl-3-triethylsilyloxyhept-6-enoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(1S,3S)-1-[(4R,5R)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]-3-ethynyl-3-triethylsilyloxyhept-6-enoxy]-dimethylsilane |
|---|---|
| PubChem CID | 101154481 |
| Molecular Formula | C28H52O4Si2 |
| Molecular Weight | 508.89 g/mol |
| Exact Mass | 508.34 |
| IUPAC Name | tert-butyl-[(1S,3S)-1-[(4R,5R)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]-3-ethynyl-3-triethylsilyloxyhept-6-enoxy]-dimethylsilane |
| SMILES | C#C[C@](CCC=C)(C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1OC(C)(C)O[C@@H]1C=C)O[Si](CC)(CC)CC |
| InChI | InChI=1S/C28H52O4Si2/c1-14-20-21-28(16-3,32-34(17-4,18-5)19-6)22-24(31-33(12,13)26(7,8)9)25-23(15-2)29-27(10,11)30-25/h3,14-15,23-25H,1-2,17-22H2,4-13H3/t23-,24+,25-,28+/m1/s1 |
| InChIKey | SHLIKKWLJYPKKZ-JHXDXHAQSA-N |
| XLogP | 7.83 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.89 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|