C15H22O4 — CID 101154488
(1R,3S,4S,8R,9Z)-6,6-dimethyl-5,7-dioxatricyclo[9.4.0.04,8]pentadeca-9,11-diene-1,3-diol (PubChem CID 101154488) has the molecular formula C15H22O4 and a molecular weight of 266.34 g/mol. Its IUPAC name is (1R,3S,4S,8R,9Z)-6,6-dimethyl-5,7-dioxatricyclo[9.4.0.04,8]pentadeca-9,11-diene-1,3-diol.
| Compound Name | (1R,3S,4S,8R,9Z)-6,6-dimethyl-5,7-dioxatricyclo[9.4.0.04,8]pentadeca-9,11-diene-1,3-diol |
|---|---|
| PubChem CID | 101154488 |
| Molecular Formula | C15H22O4 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | (1R,3S,4S,8R,9Z)-6,6-dimethyl-5,7-dioxatricyclo[9.4.0.04,8]pentadeca-9,11-diene-1,3-diol |
| SMILES | CC1(C)O[C@H]2[C@@H](O)C[C@]3(O)CCCC=C3/C=C\[C@H]2O1 |
| InChI | InChI=1S/C15H22O4/c1-14(2)18-12-7-6-10-5-3-4-8-15(10,17)9-11(16)13(12)19-14/h5-7,11-13,16-17H,3-4,8-9H2,1-2H3/b7-6-/t11-,12+,13-,15+/m0/s1 |
| InChIKey | YRQLQPHZKHHRBQ-FFHYNTOWSA-N |
| XLogP | 1.67 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |