C26H48O4Si2 — CID 101154491
tert-butyl-[[(1S,3S,4R,8R,9Z)-6,6-dimethyl-1-triethylsilyloxy-5,7-dioxatricyclo[9.3.0.04,8]tetradeca-9,11-dien-3-yl]oxy]-dimethylsilane (PubChem CID 101154491) has the molecular formula C26H48O4Si2 and a molecular weight of 480.84 g/mol. Its IUPAC name is tert-butyl-[[(1S,3S,4R,8R,9Z)-6,6-dimethyl-1-triethylsilyloxy-5,7-dioxatricyclo[9.3.0.04,8]tetradeca-9,11-dien-3-yl]oxy]-dimethylsilane.
| Compound Name | tert-butyl-[[(1S,3S,4R,8R,9Z)-6,6-dimethyl-1-triethylsilyloxy-5,7-dioxatricyclo[9.3.0.04,8]tetradeca-9,11-dien-3-yl]oxy]-dimethylsilane |
|---|---|
| PubChem CID | 101154491 |
| Molecular Formula | C26H48O4Si2 |
| Molecular Weight | 480.84 g/mol |
| Exact Mass | 480.31 |
| IUPAC Name | tert-butyl-[[(1S,3S,4R,8R,9Z)-6,6-dimethyl-1-triethylsilyloxy-5,7-dioxatricyclo[9.3.0.04,8]tetradeca-9,11-dien-3-yl]oxy]-dimethylsilane |
| SMILES | CC[Si](CC)(CC)O[C@]12CCC=C1/C=C\[C@H]1OC(C)(C)O[C@H]1[C@@H](O[Si](C)(C)C(C)(C)C)C2 |
| InChI | InChI=1S/C26H48O4Si2/c1-11-32(12-2,13-3)30-26-18-14-15-20(26)16-17-21-23(28-25(7,8)27-21)22(19-26)29-31(9,10)24(4,5)6/h15-17,21-23H,11-14,18-19H2,1-10H3/b17-16-/t21-,22+,23-,26+/m1/s1 |
| InChIKey | DGUNVJGUMDQPLK-NLUHOVPESA-N |
| XLogP | 7.34 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.84 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|