C20H34O4Si — CID 101154492
(1R,3S,4R,8R,9Z)-3-[tert-butyl(dimethyl)silyl]oxy-6,6-dimethyl-5,7-dioxatricyclo[9.3.0.04,8]tetradeca-9,11-dien-1-ol (PubChem CID 101154492) has the molecular formula C20H34O4Si and a molecular weight of 366.57 g/mol. Its IUPAC name is (1R,3S,4R,8R,9Z)-3-[tert-butyl(dimethyl)silyl]oxy-6,6-dimethyl-5,7-dioxatricyclo[9.3.0.04,8]tetradeca-9,11-dien-1-ol.
| Compound Name | (1R,3S,4R,8R,9Z)-3-[tert-butyl(dimethyl)silyl]oxy-6,6-dimethyl-5,7-dioxatricyclo[9.3.0.04,8]tetradeca-9,11-dien-1-ol |
|---|---|
| PubChem CID | 101154492 |
| Molecular Formula | C20H34O4Si |
| Molecular Weight | 366.57 g/mol |
| Exact Mass | 366.22 |
| IUPAC Name | (1R,3S,4R,8R,9Z)-3-[tert-butyl(dimethyl)silyl]oxy-6,6-dimethyl-5,7-dioxatricyclo[9.3.0.04,8]tetradeca-9,11-dien-1-ol |
| SMILES | CC1(C)O[C@H]2[C@@H](O[Si](C)(C)C(C)(C)C)C[C@]3(O)CCC=C3/C=C\[C@H]2O1 |
| InChI | InChI=1S/C20H34O4Si/c1-18(2,3)25(6,7)24-16-13-20(21)12-8-9-14(20)10-11-15-17(16)23-19(4,5)22-15/h9-11,15-17,21H,8,12-13H2,1-7H3/b11-10-/t15-,16+,17-,20-/m1/s1 |
| InChIKey | XTJJRIBEMFZCSU-HUJJFYJPSA-N |
| XLogP | 4.31 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.57 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|