C15H29BO2 — CID 101154895
2-(3-tert-butylpent-4-enyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 101154895) has the molecular formula C15H29BO2 and a molecular weight of 252.21 g/mol. Its IUPAC name is 2-(3-tert-butylpent-4-enyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-(3-tert-butylpent-4-enyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 101154895 |
| Molecular Formula | C15H29BO2 |
| Molecular Weight | 252.21 g/mol |
| Exact Mass | 252.23 |
| IUPAC Name | 2-(3-tert-butylpent-4-enyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | C=CC(CCB1OC(C)(C)C(C)(C)O1)C(C)(C)C |
| InChI | InChI=1S/C15H29BO2/c1-9-12(13(2,3)4)10-11-16-17-14(5,6)15(7,8)18-16/h9,12H,1,10-11H2,2-8H3 |
| InChIKey | POAQWQKUAIKMPK-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.21 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|