C38H30F12NO6P — CID 101154994
N-[(4aR,6S,7R,8S,8aR)-8-bis[3,5-bis(trifluoromethyl)phenyl]phosphanyloxy-2-phenyl-6-phenylmethoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]acetamide (PubChem CID 101154994) has the molecular formula C38H30F12NO6P and a molecular weight of 855.61 g/mol. Its IUPAC name is N-[(4aR,6S,7R,8S,8aR)-8-bis[3,5-bis(trifluoromethyl)phenyl]phosphanyloxy-2-phenyl-6-phenylmethoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]acetamide.
| Compound Name | N-[(4aR,6S,7R,8S,8aR)-8-bis[3,5-bis(trifluoromethyl)phenyl]phosphanyloxy-2-phenyl-6-phenylmethoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]acetamide |
|---|---|
| PubChem CID | 101154994 |
| Molecular Formula | C38H30F12NO6P |
| Molecular Weight | 855.61 g/mol |
| Exact Mass | 855.16 |
| IUPAC Name | N-[(4aR,6S,7R,8S,8aR)-8-bis[3,5-bis(trifluoromethyl)phenyl]phosphanyloxy-2-phenyl-6-phenylmethoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]acetamide |
| SMILES | CC(=O)N[C@H]1[C@@H](OCc2ccccc2)O[C@@H]2COC(c3ccccc3)O[C@H]2[C@H]1OP(c1cc(C(F)(F)F)cc(C(F)(F)F)c1)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C38H30F12NO6P/c1-20(52)51-30-32(31-29(19-54-33(56-31)22-10-6-3-7-11-22)55-34(30)53-18-21-8-4-2-5-9-21)57-58(27-14-23(35(39,40)41)12-24(15-27)36(42,43)44)28-16-25(37(45,46)47)13-26(17-28)38(48,49)50/h2-17,29-34H,18-19H2,1H3,(H,51,52)/t29-,30-,31-,32+,33?,34+/m1/s1 |
| InChIKey | VQMPCQVUKNCUJG-CHYJAYAWSA-N |
| XLogP | 9.06 |
| TPSA | 75.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 855.61 |
| LogP ≤ 5 | 9.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|