C16H20O — CID 101155750
(1S,3S,4S,5S)-3-tert-butyl-4-phenylbicyclo[3.1.0]hexan-2-one (PubChem CID 101155750) has the molecular formula C16H20O and a molecular weight of 228.34 g/mol. Its IUPAC name is (1S,3S,4S,5S)-3-tert-butyl-4-phenylbicyclo[3.1.0]hexan-2-one.
| Compound Name | (1S,3S,4S,5S)-3-tert-butyl-4-phenylbicyclo[3.1.0]hexan-2-one |
|---|---|
| PubChem CID | 101155750 |
| Molecular Formula | C16H20O |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.15 |
| IUPAC Name | (1S,3S,4S,5S)-3-tert-butyl-4-phenylbicyclo[3.1.0]hexan-2-one |
| SMILES | CC(C)(C)[C@H]1C(=O)[C@H]2C[C@H]2[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C16H20O/c1-16(2,3)14-13(10-7-5-4-6-8-10)11-9-12(11)15(14)17/h4-8,11-14H,9H2,1-3H3/t11-,12+,13+,14-/m1/s1 |
| InChIKey | UZOYTVWMMUZTOB-ZOBORPQBSA-N |
| XLogP | 3.65 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |