C18H38O4Si — CID 101155909
(3R)-3-(methoxymethoxy)-7-tri(propan-2-yl)silyloxyheptanal (PubChem CID 101155909) has the molecular formula C18H38O4Si and a molecular weight of 346.58 g/mol. Its IUPAC name is (3R)-3-(methoxymethoxy)-7-tri(propan-2-yl)silyloxyheptanal.
| Compound Name | (3R)-3-(methoxymethoxy)-7-tri(propan-2-yl)silyloxyheptanal |
|---|---|
| PubChem CID | 101155909 |
| Molecular Formula | C18H38O4Si |
| Molecular Weight | 346.58 g/mol |
| Exact Mass | 346.25 |
| IUPAC Name | (3R)-3-(methoxymethoxy)-7-tri(propan-2-yl)silyloxyheptanal |
| SMILES | COCO[C@@H](CC=O)CCCCO[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C18H38O4Si/c1-15(2)23(16(3)4,17(5)6)22-13-9-8-10-18(11-12-19)21-14-20-7/h12,15-18H,8-11,13-14H2,1-7H3/t18-/m1/s1 |
| InChIKey | XGUSXCMYLNOUGP-GOSISDBHSA-N |
| XLogP | 4.93 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.58 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|