About butyl N-[4-[4-[5-(2,6-difluorophenyl)-3,4-dihydro-2H-pyrrol-2-yl]phenyl]phenyl]-N-methylcarbamate
butyl N-[4-[4-[5-(2,6-difluorophenyl)-3,4-dihydro-2H-pyrrol-2-yl]phenyl]phenyl]-N-methylcarbamate (PubChem CID 10115633) has the molecular formula C28H28F2N2O2
and a molecular weight of 462.54 g/mol. Its IUPAC name is butyl N-[4-[4-[5-(2,6-difluorophenyl)-3,4-dihydro-2H-pyrrol-2-yl]phenyl]phenyl]-N-methylcarbamate.
Molecular Properties
| Compound Name | butyl N-[4-[4-[5-(2,6-difluorophenyl)-3,4-dihydro-2H-pyrrol-2-yl]phenyl]phenyl]-N-methylcarbamate |
| PubChem CID | 10115633 |
| Molecular Formula | C28H28F2N2O2 |
| Molecular Weight | 462.54 g/mol |
| Exact Mass | 462.21 |
| IUPAC Name | butyl N-[4-[4-[5-(2,6-difluorophenyl)-3,4-dihydro-2H-pyrrol-2-yl]phenyl]phenyl]-N-methylcarbamate |
| SMILES | CCCCOC(=O)N(C)c1ccc(-c2ccc(C3CCC(c4c(F)cccc4F)=N3)cc2)cc1 |
| InChI | InChI=1S/C28H28F2N2O2/c1-3-4-18-34-28(33)32(2)22-14-12-20(13-15-22)19-8-10-21(11-9-19)25-16-17-26(31-25)27-23(29)6-5-7-24(27)30/h5-15,25H,3-4,16-18H2,1-2H3 |
| InChIKey | GDADBIZKPZIVKI-UHFFFAOYSA-N |
| XLogP | 7.33 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 462.54 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze butyl N-[4-[4-[5-(2,6-difluorophenyl)-3,4-dihydro-2H-pyrrol-2-yl]phenyl]phenyl]-N-methylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butyl N-[4-[4-[5-(2,6-difluorophenyl)-3,4-dihydro-2H-pyrrol-2-yl]phenyl]phenyl]-N-methylcarbamate?
The IUPAC name of butyl N-[4-[4-[5-(2,6-difluorophenyl)-3,4-dihydro-2H-pyrrol-2-yl]phenyl]phenyl]-N-methylcarbamate (CID 10115633) is butyl N-[4-[4-[5-(2,6-difluorophenyl)-3,4-dihydro-2H-pyrrol-2-yl]phenyl]phenyl]-N-methylcarbamate.
What is the SMILES notation for butyl N-[4-[4-[5-(2,6-difluorophenyl)-3,4-dihydro-2H-pyrrol-2-yl]phenyl]phenyl]-N-methylcarbamate?
The canonical SMILES for butyl N-[4-[4-[5-(2,6-difluorophenyl)-3,4-dihydro-2H-pyrrol-2-yl]phenyl]phenyl]-N-methylcarbamate is CCCCOC(=O)N(C)c1ccc(-c2ccc(C3CCC(c4c(F)cccc4F)=N3)cc2)cc1.
What is the InChIKey of butyl N-[4-[4-[5-(2,6-difluorophenyl)-3,4-dihydro-2H-pyrrol-2-yl]phenyl]phenyl]-N-methylcarbamate?
The InChIKey is GDADBIZKPZIVKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H28F2N2O2/c1-3-4-18-34-28(33)32(2)22-14-12-20(13-15-22)19-8-10-21(11-9-19)25-16-17-26(31-25)27-23(29)6-5-7-24(27)30/h5-15,25H,3-4,16-18H2,1-2H3.
What are the key properties of butyl N-[4-[4-[5-(2,6-difluorophenyl)-3,4-dihydro-2H-pyrrol-2-yl]phenyl]phenyl]-N-methylcarbamate?
butyl N-[4-[4-[5-(2,6-difluorophenyl)-3,4-dihydro-2H-pyrrol-2-yl]phenyl]phenyl]-N-methylcarbamate has a molecular weight of 462.54 g/mol, XLogP of 7.33, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for butyl N-[4-[4-[5-(2,6-difluorophenyl)-3,4-dihydro-2H-pyrrol-2-yl]phenyl]phenyl]-N-methylcarbamate is sourced from PubChem (CID 10115633), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).