About 3-[1-[4,4-bis(4-fluorophenyl)butyl]piperidin-4-yl]-1,3-benzoxazol-2-one
3-[1-[4,4-bis(4-fluorophenyl)butyl]piperidin-4-yl]-1,3-benzoxazol-2-one (PubChem CID 10115634) has the molecular formula C28H28F2N2O2
and a molecular weight of 462.54 g/mol. Its IUPAC name is 3-[1-[4,4-bis(4-fluorophenyl)butyl]piperidin-4-yl]-1,3-benzoxazol-2-one.
Molecular Properties
| Compound Name | 3-[1-[4,4-bis(4-fluorophenyl)butyl]piperidin-4-yl]-1,3-benzoxazol-2-one |
| PubChem CID | 10115634 |
| Molecular Formula | C28H28F2N2O2 |
| Molecular Weight | 462.54 g/mol |
| Exact Mass | 462.21 |
| IUPAC Name | 3-[1-[4,4-bis(4-fluorophenyl)butyl]piperidin-4-yl]-1,3-benzoxazol-2-one |
| SMILES | O=c1oc2ccccc2n1C1CCN(CCCC(c2ccc(F)cc2)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C28H28F2N2O2/c29-22-11-7-20(8-12-22)25(21-9-13-23(30)14-10-21)4-3-17-31-18-15-24(16-19-31)32-26-5-1-2-6-27(26)34-28(32)33/h1-2,5-14,24-25H,3-4,15-19H2 |
| InChIKey | QVHACLVZKFBMLI-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 38.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 462.54 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[1-[4,4-bis(4-fluorophenyl)butyl]piperidin-4-yl]-1,3-benzoxazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[1-[4,4-bis(4-fluorophenyl)butyl]piperidin-4-yl]-1,3-benzoxazol-2-one?
The IUPAC name of 3-[1-[4,4-bis(4-fluorophenyl)butyl]piperidin-4-yl]-1,3-benzoxazol-2-one (CID 10115634) is 3-[1-[4,4-bis(4-fluorophenyl)butyl]piperidin-4-yl]-1,3-benzoxazol-2-one.
What is the SMILES notation for 3-[1-[4,4-bis(4-fluorophenyl)butyl]piperidin-4-yl]-1,3-benzoxazol-2-one?
The canonical SMILES for 3-[1-[4,4-bis(4-fluorophenyl)butyl]piperidin-4-yl]-1,3-benzoxazol-2-one is O=c1oc2ccccc2n1C1CCN(CCCC(c2ccc(F)cc2)c2ccc(F)cc2)CC1.
What is the InChIKey of 3-[1-[4,4-bis(4-fluorophenyl)butyl]piperidin-4-yl]-1,3-benzoxazol-2-one?
The InChIKey is QVHACLVZKFBMLI-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H28F2N2O2/c29-22-11-7-20(8-12-22)25(21-9-13-23(30)14-10-21)4-3-17-31-18-15-24(16-19-31)32-26-5-1-2-6-27(26)34-28(32)33/h1-2,5-14,24-25H,3-4,15-19H2.
What are the key properties of 3-[1-[4,4-bis(4-fluorophenyl)butyl]piperidin-4-yl]-1,3-benzoxazol-2-one?
3-[1-[4,4-bis(4-fluorophenyl)butyl]piperidin-4-yl]-1,3-benzoxazol-2-one has a molecular weight of 462.54 g/mol, XLogP of 6.12, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[1-[4,4-bis(4-fluorophenyl)butyl]piperidin-4-yl]-1,3-benzoxazol-2-one is sourced from PubChem (CID 10115634), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).