C22H34N6O5 — CID 10115641
(2S)-1-[2-(4-aminoanilino)acetyl]-N-[(2R)-1-[[(2S)-1-(hydroxyamino)-1-oxopropan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]pyrrolidine-2-carboxamide (PubChem CID 10115641) has the molecular formula C22H34N6O5 and a molecular weight of 462.55 g/mol. Its IUPAC name is (2S)-1-[2-(4-aminoanilino)acetyl]-N-[(2R)-1-[[(2S)-1-(hydroxyamino)-1-oxopropan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]pyrrolidine-2-carboxamide.
| Compound Name | (2S)-1-[2-(4-aminoanilino)acetyl]-N-[(2R)-1-[[(2S)-1-(hydroxyamino)-1-oxopropan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 10115641 |
| Molecular Formula | C22H34N6O5 |
| Molecular Weight | 462.55 g/mol |
| Exact Mass | 462.26 |
| IUPAC Name | (2S)-1-[2-(4-aminoanilino)acetyl]-N-[(2R)-1-[[(2S)-1-(hydroxyamino)-1-oxopropan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]pyrrolidine-2-carboxamide |
| SMILES | CC(C)C[C@@H](NC(=O)[C@@H]1CCCN1C(=O)CNc1ccc(N)cc1)C(=O)N[C@@H](C)C(=O)NO |
| InChI | InChI=1S/C22H34N6O5/c1-13(2)11-17(21(31)25-14(3)20(30)27-33)26-22(32)18-5-4-10-28(18)19(29)12-24-16-8-6-15(23)7-9-16/h6-9,13-14,17-18,24,33H,4-5,10-12,23H2,1-3H3,(H,25,31)(H,26,32)(H,27,30)/t14-,17+,18-/m0/s1 |
| InChIKey | QIAYOCHHKYKRPH-QGTPRVQTSA-N |
| XLogP | 0.21 |
| TPSA | 165.89 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.55 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|