About CID 101156417
CID 101156417 (PubChem CID 101156417) has the molecular formula C22H41N4O4
and a molecular weight of 425.59 g/mol.
Molecular Properties
| Compound Name | CID 101156417 |
| PubChem CID | 101156417 |
| Molecular Formula | C22H41N4O4 |
| Molecular Weight | 425.59 g/mol |
| Exact Mass | 425.31 |
| IUPAC Name | — |
| SMILES | CC(=O)NC1(C(=O)N[C@](C)(C(=O)NC(C)(C)C)C(C)C)CC(C)(C)N([O])C(C)(C)C1 |
| InChI | InChI=1S/C22H41N4O4/c1-14(2)21(11,16(28)24-18(4,5)6)25-17(29)22(23-15(3)27)12-19(7,8)26(30)20(9,10)13-22/h14H,12-13H2,1-11H3,(H,23,27)(H,24,28)(H,25,29)/t21-/m0/s1 |
| InChIKey | ZAZVVPOXNHJMGD-NRFANRHFSA-N |
| XLogP | 2.31 |
| TPSA | 110.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 425.59 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze CID 101156417 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 101156417?
The IUPAC name of CID 101156417 (CID 101156417) is not available.
What is the SMILES notation for CID 101156417?
The canonical SMILES for CID 101156417 is CC(=O)NC1(C(=O)N[C@](C)(C(=O)NC(C)(C)C)C(C)C)CC(C)(C)N([O])C(C)(C)C1.
What is the InChIKey of CID 101156417?
The InChIKey is ZAZVVPOXNHJMGD-NRFANRHFSA-N. The full InChI is InChI=1S/C22H41N4O4/c1-14(2)21(11,16(28)24-18(4,5)6)25-17(29)22(23-15(3)27)12-19(7,8)26(30)20(9,10)13-22/h14H,12-13H2,1-11H3,(H,23,27)(H,24,28)(H,25,29)/t21-/m0/s1.
What are the key properties of CID 101156417?
CID 101156417 has a molecular weight of 425.59 g/mol, XLogP of 2.31, 5 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 101156417 is sourced from PubChem (CID 101156417), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).