C21H36O4 — CID 101156452
ethyl (3E,7E)-4,8-dimethyl-10-[(4R)-2,2,5,5-tetramethyl-1,3-dioxolan-4-yl]deca-3,7-dienoate (PubChem CID 101156452) has the molecular formula C21H36O4 and a molecular weight of 352.52 g/mol. Its IUPAC name is ethyl (3E,7E)-4,8-dimethyl-10-[(4R)-2,2,5,5-tetramethyl-1,3-dioxolan-4-yl]deca-3,7-dienoate.
| Compound Name | ethyl (3E,7E)-4,8-dimethyl-10-[(4R)-2,2,5,5-tetramethyl-1,3-dioxolan-4-yl]deca-3,7-dienoate |
|---|---|
| PubChem CID | 101156452 |
| Molecular Formula | C21H36O4 |
| Molecular Weight | 352.52 g/mol |
| Exact Mass | 352.26 |
| IUPAC Name | ethyl (3E,7E)-4,8-dimethyl-10-[(4R)-2,2,5,5-tetramethyl-1,3-dioxolan-4-yl]deca-3,7-dienoate |
| SMILES | CCOC(=O)C/C=C(\C)CC/C=C(\C)CC[C@H]1OC(C)(C)OC1(C)C |
| InChI | InChI=1S/C21H36O4/c1-8-23-19(22)15-13-17(3)11-9-10-16(2)12-14-18-20(4,5)25-21(6,7)24-18/h10,13,18H,8-9,11-12,14-15H2,1-7H3/b16-10+,17-13+/t18-/m1/s1 |
| InChIKey | JWIBIFKVRFXTBJ-ANFLJRJNSA-N |
| XLogP | 5.32 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.52 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|