C33H58O3Si — CID 101156633
tert-butyl-[(4R,5E,7E,10R,11Z,13E)-12-ethyl-4,6,10-trimethyl-14-[(2R,6R)-6-propan-2-yloxy-3,6-dihydro-2H-pyran-2-yl]tetradeca-5,7,11,13-tetraen-3-yl]oxy-dimethylsilane (PubChem CID 101156633) has the molecular formula C33H58O3Si and a molecular weight of 530.91 g/mol. Its IUPAC name is tert-butyl-[(4R,5E,7E,10R,11Z,13E)-12-ethyl-4,6,10-trimethyl-14-[(2R,6R)-6-propan-2-yloxy-3,6-dihydro-2H-pyran-2-yl]tetradeca-5,7,11,13-tetraen-3-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(4R,5E,7E,10R,11Z,13E)-12-ethyl-4,6,10-trimethyl-14-[(2R,6R)-6-propan-2-yloxy-3,6-dihydro-2H-pyran-2-yl]tetradeca-5,7,11,13-tetraen-3-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 101156633 |
| Molecular Formula | C33H58O3Si |
| Molecular Weight | 530.91 g/mol |
| Exact Mass | 530.42 |
| IUPAC Name | tert-butyl-[(4R,5E,7E,10R,11Z,13E)-12-ethyl-4,6,10-trimethyl-14-[(2R,6R)-6-propan-2-yloxy-3,6-dihydro-2H-pyran-2-yl]tetradeca-5,7,11,13-tetraen-3-yl]oxy-dimethylsilane |
| SMILES | CCC(=C/[C@H](C)C/C=C/C(C)=C/[C@@H](C)C(CC)O[Si](C)(C)C(C)(C)C)/C=C/[C@H]1CC=C[C@H](OC(C)C)O1 |
| InChI | InChI=1S/C33H58O3Si/c1-13-29(21-22-30-19-16-20-32(35-30)34-25(3)4)24-27(6)18-15-17-26(5)23-28(7)31(14-2)36-37(11,12)33(8,9)10/h15-17,20-25,27-28,30-32H,13-14,18-19H2,1-12H3/b17-15+,22-21+,26-23+,29-24-/t27-,28-,30-,31?,32-/m1/s1 |
| InChIKey | BVYKSWLTKGTREL-MYSAQWKLSA-N |
| XLogP | 9.94 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.91 |
| LogP ≤ 5 | 9.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|