C18H20F3N3O6 — CID 101156763
diethyl (3R)-4,4-dicyano-3-(2-oxopropyl)-1-(2,2,2-trifluoroacetyl)piperidine-2,2-dicarboxylate (PubChem CID 101156763) has the molecular formula C18H20F3N3O6 and a molecular weight of 431.37 g/mol. Its IUPAC name is diethyl (3R)-4,4-dicyano-3-(2-oxopropyl)-1-(2,2,2-trifluoroacetyl)piperidine-2,2-dicarboxylate.
| Compound Name | diethyl (3R)-4,4-dicyano-3-(2-oxopropyl)-1-(2,2,2-trifluoroacetyl)piperidine-2,2-dicarboxylate |
|---|---|
| PubChem CID | 101156763 |
| Molecular Formula | C18H20F3N3O6 |
| Molecular Weight | 431.37 g/mol |
| Exact Mass | 431.13 |
| IUPAC Name | diethyl (3R)-4,4-dicyano-3-(2-oxopropyl)-1-(2,2,2-trifluoroacetyl)piperidine-2,2-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)[C@H](CC(C)=O)C(C#N)(C#N)CCN1C(=O)C(F)(F)F |
| InChI | InChI=1S/C18H20F3N3O6/c1-4-29-14(27)17(15(28)30-5-2)12(8-11(3)25)16(9-22,10-23)6-7-24(17)13(26)18(19,20)21/h12H,4-8H2,1-3H3/t12-/m1/s1 |
| InChIKey | GKUIDXVMLLDMGW-GFCCVEGCSA-N |
| XLogP | 1.27 |
| TPSA | 137.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.37 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|