C10H11BrO4 — CID 101156916
(1R,4S,5R,8R)-5-bromo-10,10-dimethyl-3,9,11-trioxatricyclo[6.3.0.01,4]undec-6-en-2-one (PubChem CID 101156916) has the molecular formula C10H11BrO4 and a molecular weight of 275.10 g/mol. Its IUPAC name is (1R,4S,5R,8R)-5-bromo-10,10-dimethyl-3,9,11-trioxatricyclo[6.3.0.01,4]undec-6-en-2-one.
| Compound Name | (1R,4S,5R,8R)-5-bromo-10,10-dimethyl-3,9,11-trioxatricyclo[6.3.0.01,4]undec-6-en-2-one |
|---|---|
| PubChem CID | 101156916 |
| Molecular Formula | C10H11BrO4 |
| Molecular Weight | 275.10 g/mol |
| Exact Mass | 273.98 |
| IUPAC Name | (1R,4S,5R,8R)-5-bromo-10,10-dimethyl-3,9,11-trioxatricyclo[6.3.0.01,4]undec-6-en-2-one |
| SMILES | CC1(C)O[C@@H]2C=C[C@@H](Br)[C@H]3OC(=O)[C@]32O1 |
| InChI | InChI=1S/C10H11BrO4/c1-9(2)14-6-4-3-5(11)7-10(6,15-9)8(12)13-7/h3-7H,1-2H3/t5-,6-,7-,10-/m1/s1 |
| InChIKey | VKPMGKHCUCLUPC-DAGMQNCNSA-N |
| XLogP | 1.14 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.10 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'four_member_lactones', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|