C48H66O4Si4 — CID 101157186
[3-[12-[3,5-bis[[tert-butyl(dimethyl)silyl]oxy]phenyl]dodeca-1,3,5,7,9,11-hexaynyl]-5-[tert-butyl(dimethyl)silyl]oxyphenoxy]-tert-butyl-dimethylsilane (PubChem CID 101157186) has the molecular formula C48H66O4Si4 and a molecular weight of 819.40 g/mol. Its IUPAC name is [3-[12-[3,5-bis[[tert-butyl(dimethyl)silyl]oxy]phenyl]dodeca-1,3,5,7,9,11-hexaynyl]-5-[tert-butyl(dimethyl)silyl]oxyphenoxy]-tert-butyl-dimethylsilane.
| Compound Name | [3-[12-[3,5-bis[[tert-butyl(dimethyl)silyl]oxy]phenyl]dodeca-1,3,5,7,9,11-hexaynyl]-5-[tert-butyl(dimethyl)silyl]oxyphenoxy]-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 101157186 |
| Molecular Formula | C48H66O4Si4 |
| Molecular Weight | 819.40 g/mol |
| Exact Mass | 818.40 |
| IUPAC Name | [3-[12-[3,5-bis[[tert-butyl(dimethyl)silyl]oxy]phenyl]dodeca-1,3,5,7,9,11-hexaynyl]-5-[tert-butyl(dimethyl)silyl]oxyphenoxy]-tert-butyl-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)Oc1cc(C#CC#CC#CC#CC#CC#Cc2cc(O[Si](C)(C)C(C)(C)C)cc(O[Si](C)(C)C(C)(C)C)c2)cc(O[Si](C)(C)C(C)(C)C)c1 |
| InChI | InChI=1S/C48H66O4Si4/c1-45(2,3)53(13,14)49-41-33-39(34-42(37-41)50-54(15,16)46(4,5)6)31-29-27-25-23-21-22-24-26-28-30-32-40-35-43(51-55(17,18)47(7,8)9)38-44(36-40)52-56(19,20)48(10,11)12/h33-38H,1-20H3 |
| InChIKey | OGSRXAAWWHMIGT-UHFFFAOYSA-N |
| XLogP | 12.64 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 819.40 |
| LogP ≤ 5 | 12.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|