C44H66O4Si4 — CID 101157190
[3-[8-[3,5-bis[[tert-butyl(dimethyl)silyl]oxy]phenyl]octa-1,3,5,7-tetraynyl]-5-[tert-butyl(dimethyl)silyl]oxyphenoxy]-tert-butyl-dimethylsilane (PubChem CID 101157190) has the molecular formula C44H66O4Si4 and a molecular weight of 771.35 g/mol. Its IUPAC name is [3-[8-[3,5-bis[[tert-butyl(dimethyl)silyl]oxy]phenyl]octa-1,3,5,7-tetraynyl]-5-[tert-butyl(dimethyl)silyl]oxyphenoxy]-tert-butyl-dimethylsilane.
| Compound Name | [3-[8-[3,5-bis[[tert-butyl(dimethyl)silyl]oxy]phenyl]octa-1,3,5,7-tetraynyl]-5-[tert-butyl(dimethyl)silyl]oxyphenoxy]-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 101157190 |
| Molecular Formula | C44H66O4Si4 |
| Molecular Weight | 771.35 g/mol |
| Exact Mass | 770.40 |
| IUPAC Name | [3-[8-[3,5-bis[[tert-butyl(dimethyl)silyl]oxy]phenyl]octa-1,3,5,7-tetraynyl]-5-[tert-butyl(dimethyl)silyl]oxyphenoxy]-tert-butyl-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)Oc1cc(C#CC#CC#CC#Cc2cc(O[Si](C)(C)C(C)(C)C)cc(O[Si](C)(C)C(C)(C)C)c2)cc(O[Si](C)(C)C(C)(C)C)c1 |
| InChI | InChI=1S/C44H66O4Si4/c1-41(2,3)49(13,14)45-37-29-35(30-38(33-37)46-50(15,16)42(4,5)6)27-25-23-21-22-24-26-28-36-31-39(47-51(17,18)43(7,8)9)34-40(32-36)48-52(19,20)44(10,11)12/h29-34H,1-20H3 |
| InChIKey | BQSGRFJOSLZQPW-UHFFFAOYSA-N |
| XLogP | 12.63 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 771.35 |
| LogP ≤ 5 | 12.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|